2-hept-6-enyl-4,6-dimethoxybenzoic acid

C16H22O4 — CID 134858465

IUPAC2-hept-6-enyl-4,6-dimethoxybenzoic acid
SMILESC=CCCCCCc1cc(OC)cc(OC)c1C(=O)O
InChIInChI=1S/C16H22O4/c1-4-5-6-7-8-9-12-10-13(19-2)11-14(20-3)15(12)16(17)18/h4,10-11H,1,5-9H2,2-3H3,(H,17,18)
InChIKeyVZXMLJWNATVLLQ-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.69
Rot. Bonds9

About 2-hept-6-enyl-4,6-dimethoxybenzoic acid

2-hept-6-enyl-4,6-dimethoxybenzoic acid (PubChem CID 134858465) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-hept-6-enyl-4,6-dimethoxybenzoic acid.

Molecular Properties

Compound Name2-hept-6-enyl-4,6-dimethoxybenzoic acid
PubChem CID134858465
Molecular FormulaC16H22O4
Molecular Weight278.35 g/mol
Exact Mass278.15
IUPAC Name2-hept-6-enyl-4,6-dimethoxybenzoic acid
SMILESC=CCCCCCc1cc(OC)cc(OC)c1C(=O)O
InChIInChI=1S/C16H22O4/c1-4-5-6-7-8-9-12-10-13(19-2)11-14(20-3)15(12)16(17)18/h4,10-11H,1,5-9H2,2-3H3,(H,17,18)
InChIKeyVZXMLJWNATVLLQ-UHFFFAOYSA-N
XLogP3.69
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-hept-6-enyl-4,6-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hept-6-enyl-4,6-dimethoxybenzoic acid?
The IUPAC name of 2-hept-6-enyl-4,6-dimethoxybenzoic acid (CID 134858465) is 2-hept-6-enyl-4,6-dimethoxybenzoic acid.
What is the SMILES notation for 2-hept-6-enyl-4,6-dimethoxybenzoic acid?
The canonical SMILES for 2-hept-6-enyl-4,6-dimethoxybenzoic acid is C=CCCCCCc1cc(OC)cc(OC)c1C(=O)O.
What is the InChIKey of 2-hept-6-enyl-4,6-dimethoxybenzoic acid?
The InChIKey is VZXMLJWNATVLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-4-5-6-7-8-9-12-10-13(19-2)11-14(20-3)15(12)16(17)18/h4,10-11H,1,5-9H2,2-3H3,(H,17,18).
What are the key properties of 2-hept-6-enyl-4,6-dimethoxybenzoic acid?
2-hept-6-enyl-4,6-dimethoxybenzoic acid has a molecular weight of 278.35 g/mol, XLogP of 3.69, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hept-6-enyl-4,6-dimethoxybenzoic acid is sourced from PubChem (CID 134858465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).