C14H14ClN3O5 — CID 14425856
2-chloroethyl 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate (PubChem CID 14425856) has the molecular formula C14H14ClN3O5 and a molecular weight of 339.74 g/mol. Its IUPAC name is 2-chloroethyl 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate.
| Compound Name | 2-chloroethyl 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 14425856 |
| Molecular Formula | C14H14ClN3O5 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-chloroethyl 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate |
| SMILES | COc1cc(OC)nc(Oc2cccnc2C(=O)OCCCl)n1 |
| InChI | InChI=1S/C14H14ClN3O5/c1-20-10-8-11(21-2)18-14(17-10)23-9-4-3-6-16-12(9)13(19)22-7-5-15/h3-4,6,8H,5,7H2,1-2H3 |
| InChIKey | PBOLVBMNGWIZIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|