C21H28N4O5 — CID 14648785
(nonan-5-ylideneamino) 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate (PubChem CID 14648785) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (nonan-5-ylideneamino) 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate.
| Compound Name | (nonan-5-ylideneamino) 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 14648785 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (nonan-5-ylideneamino) 3-(4,6-dimethoxypyrimidin-2-yl)oxypyridine-2-carboxylate |
| SMILES | CCCCC(CCCC)=NOC(=O)c1ncccc1Oc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C21H28N4O5/c1-5-7-10-15(11-8-6-2)25-30-20(26)19-16(12-9-13-22-19)29-21-23-17(27-3)14-18(24-21)28-4/h9,12-14H,5-8,10-11H2,1-4H3 |
| InChIKey | JGIVMRCNZDBSNY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|