C14H18N4O3 — CID 115355315
N-[2-(4-aminophenoxy)ethyl]-4,6-dimethoxypyrimidin-2-amine (PubChem CID 115355315) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[2-(4-aminophenoxy)ethyl]-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | N-[2-(4-aminophenoxy)ethyl]-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 115355315 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N-[2-(4-aminophenoxy)ethyl]-4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NCCOc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C14H18N4O3/c1-19-12-9-13(20-2)18-14(17-12)16-7-8-21-11-5-3-10(15)4-6-11/h3-6,9H,7-8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | FBGSKKFJDRWKJK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|