C47H37N2OP — CID 139516675
2-[4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]naphthalen-1-yl]phenyl]-4,5,6-trimethylpyrimidine (PubChem CID 139516675) has the molecular formula C47H37N2OP and a molecular weight of 676.80 g/mol. Its IUPAC name is 2-[4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]naphthalen-1-yl]phenyl]-4,5,6-trimethylpyrimidine.
| Compound Name | 2-[4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]naphthalen-1-yl]phenyl]-4,5,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 139516675 |
| Molecular Formula | C47H37N2OP |
| Molecular Weight | 676.80 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 2-[4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]naphthalen-1-yl]phenyl]-4,5,6-trimethylpyrimidine |
| SMILES | Cc1nc(-c2ccc(-c3ccc(-c4ccc(-c5ccc(P(=O)(c6ccccc6)c6ccccc6)cc5)cc4)c4ccccc34)cc2)nc(C)c1C |
| InChI | InChI=1S/C47H37N2OP/c1-32-33(2)48-47(49-34(32)3)39-24-22-38(23-25-39)44-31-30-43(45-16-10-11-17-46(44)45)37-20-18-35(19-21-37)36-26-28-42(29-27-36)51(50,40-12-6-4-7-13-40)41-14-8-5-9-15-41/h4-31H,1-3H3 |
| InChIKey | QFEUMMCPCUNEAU-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.80 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|