C57H40N4 — CID 138736699
3-[(3Z)-4-[2-methyl-1-[4-(4-naphthalen-2-yl-6-phenylpyrimidin-2-yl)phenyl]indol-3-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole (PubChem CID 138736699) has the molecular formula C57H40N4 and a molecular weight of 780.97 g/mol. Its IUPAC name is 3-[(3Z)-4-[2-methyl-1-[4-(4-naphthalen-2-yl-6-phenylpyrimidin-2-yl)phenyl]indol-3-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole.
| Compound Name | 3-[(3Z)-4-[2-methyl-1-[4-(4-naphthalen-2-yl-6-phenylpyrimidin-2-yl)phenyl]indol-3-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 138736699 |
| Molecular Formula | C57H40N4 |
| Molecular Weight | 780.97 g/mol |
| Exact Mass | 780.33 |
| IUPAC Name | 3-[(3Z)-4-[2-methyl-1-[4-(4-naphthalen-2-yl-6-phenylpyrimidin-2-yl)phenyl]indol-3-yl]buta-1,3-dien-2-yl]-9-phenylcarbazole |
| SMILES | C=C(/C=C\c1c(C)n(-c2ccc(-c3nc(-c4ccccc4)cc(-c4ccc5ccccc5c4)n3)cc2)c2ccccc12)c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C57H40N4/c1-38(43-30-34-56-51(36-43)50-22-12-14-24-55(50)61(56)46-19-7-4-8-20-46)25-33-48-39(2)60(54-23-13-11-21-49(48)54)47-31-28-42(29-32-47)57-58-52(41-16-5-3-6-17-41)37-53(59-57)45-27-26-40-15-9-10-18-44(40)35-45/h3-37H,1H2,2H3/b33-25- |
| InChIKey | WDTMHGHTFXKHOJ-IVQJCJPDSA-N |
| XLogP | 14.71 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.97 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|