C52H35N3S — CID 165098851
11-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-[1]benzothiolo[3,2-b]carbazole (PubChem CID 165098851) has the molecular formula C52H35N3S and a molecular weight of 733.94 g/mol. Its IUPAC name is 11-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-[1]benzothiolo[3,2-b]carbazole.
| Compound Name | 11-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-[1]benzothiolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 165098851 |
| Molecular Formula | C52H35N3S |
| Molecular Weight | 733.94 g/mol |
| Exact Mass | 733.26 |
| IUPAC Name | 11-[4-(4,6-diphenylpyrimidin-2-yl)-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-[1]benzothiolo[3,2-b]carbazole |
| SMILES | C=C/C=C(\C=C)c1cc(-c2nc(-c3ccccc3)cc(-c3ccccc3)n2)cc(-c2ccccc2)c1-n1c2ccccc2c2cc3sc4ccccc4c3cc21 |
| InChI | InChI=1S/C52H35N3S/c1-3-18-34(4-2)41-29-38(52-53-45(36-21-10-6-11-22-36)33-46(54-52)37-23-12-7-13-24-37)30-42(35-19-8-5-9-20-35)51(41)55-47-27-16-14-25-39(47)43-32-50-44(31-48(43)55)40-26-15-17-28-49(40)56-50/h3-33H,1-2H2/b34-18+ |
| InChIKey | ADTQVBVWPWCCSF-FABQOPTDSA-N |
| XLogP | 14.36 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.94 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|