C58H44N4 — CID 168748179
12-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 168748179) has the molecular formula C58H44N4 and a molecular weight of 797.02 g/mol. Its IUPAC name is 12-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 168748179 |
| Molecular Formula | C58H44N4 |
| Molecular Weight | 797.02 g/mol |
| Exact Mass | 796.36 |
| IUPAC Name | 12-[4-[6-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-phenylpyrimidin-4-yl]-2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenylphenyl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | C=C/C=C(\C=C)c1cc(-c2cc(C(/C=C\C)=C/C)nc(-c3ccccc3)n2)cc(-c2ccccc2)c1-n1c2ccccc2c2ccc3c4ccccc4n(-c4ccccc4)c3c21 |
| InChI | InChI=1S/C58H44N4/c1-5-22-39(7-3)49-36-43(52-38-51(40(8-4)23-6-2)59-58(60-52)42-26-14-10-15-27-42)37-50(41-24-12-9-13-25-41)55(49)62-54-33-21-19-31-46(54)48-35-34-47-45-30-18-20-32-53(45)61(56(47)57(48)62)44-28-16-11-17-29-44/h5-38H,1,3H2,2,4H3/b23-6-,39-22+,40-8+ |
| InChIKey | KRTRYEOOKBSXTB-DJSJKDQZSA-N |
| XLogP | 15.41 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.02 |
| LogP ≤ 5 | 15.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|