C78H55N5 — CID 146281302
2-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-6-(2,4,6-trimethylphenyl)carbazole (PubChem CID 146281302) has the molecular formula C78H55N5 and a molecular weight of 1062.33 g/mol. Its IUPAC name is 2-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-6-(2,4,6-trimethylphenyl)carbazole.
| Compound Name | 2-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-6-(2,4,6-trimethylphenyl)carbazole |
|---|---|
| PubChem CID | 146281302 |
| Molecular Formula | C78H55N5 |
| Molecular Weight | 1062.33 g/mol |
| Exact Mass | 1061.45 |
| IUPAC Name | 2-carbazol-9-yl-9-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-2,6-bis(4-phenylphenyl)phenyl]-6-(2,4,6-trimethylphenyl)carbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccc(-n4c5ccccc5c5ccccc54)cc2n3-c2c(-c3ccc(-c4ccccc4)cc3)cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2-c2ccc(-c3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C78H55N5/c1-50-44-51(2)74(52(3)45-50)61-40-43-72-69(46-61)66-42-41-63(82-70-30-18-16-28-64(70)65-29-17-19-31-71(65)82)49-73(66)83(72)75-67(57-36-32-55(33-37-57)53-20-8-4-9-21-53)47-62(48-68(75)58-38-34-56(35-39-58)54-22-10-5-11-23-54)78-80-76(59-24-12-6-13-25-59)79-77(81-78)60-26-14-7-15-27-60/h4-49H,1-3H3 |
| InChIKey | MLQRXYSAZJZNHP-UHFFFAOYSA-N |
| XLogP | 20.33 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.33 |
| LogP ≤ 5 | 20.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |