C81H54N4 — CID 153301126
9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,4,5,8-tetraphenylcarbazole (PubChem CID 153301126) has the molecular formula C81H54N4 and a molecular weight of 1083.35 g/mol. Its IUPAC name is 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,4,5,8-tetraphenylcarbazole.
| Compound Name | 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,4,5,8-tetraphenylcarbazole |
|---|---|
| PubChem CID | 153301126 |
| Molecular Formula | C81H54N4 |
| Molecular Weight | 1083.35 g/mol |
| Exact Mass | 1082.43 |
| IUPAC Name | 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,4,5,8-tetraphenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccccc5)c(-n5c6c(-c7ccccc7)ccc(-c7ccccc7)c6c6c(-c7ccccc7)ccc(-c7ccccc7)c65)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C81H54N4/c1-9-25-55(26-10-1)57-41-45-65(46-42-57)79-82-80(66-47-43-58(44-48-66)56-27-11-2-12-28-56)84-81(83-79)67-53-72(63-37-21-7-22-38-63)76(73(54-67)64-39-23-8-24-40-64)85-77-70(61-33-17-5-18-34-61)51-49-68(59-29-13-3-14-30-59)74(77)75-69(60-31-15-4-16-32-60)50-52-71(78(75)85)62-35-19-6-20-36-62/h1-54H |
| InChIKey | HELNFPCKZGZZNF-UHFFFAOYSA-N |
| XLogP | 21.31 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.35 |
| LogP ≤ 5 | 21.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |