C82H55N3 — CID 169056298
9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,3,6,8-tetraphenylcarbazole (PubChem CID 169056298) has the molecular formula C82H55N3 and a molecular weight of 1082.36 g/mol. Its IUPAC name is 9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,3,6,8-tetraphenylcarbazole.
| Compound Name | 9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,3,6,8-tetraphenylcarbazole |
|---|---|
| PubChem CID | 169056298 |
| Molecular Formula | C82H55N3 |
| Molecular Weight | 1082.36 g/mol |
| Exact Mass | 1081.44 |
| IUPAC Name | 9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,3,6,8-tetraphenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cc(-c5ccccc5)c(-n5c6c(-c7ccccc7)cc(-c7ccccc7)cc6c6cc(-c7ccccc7)cc(-c7ccccc7)c65)c(-c5ccccc5)c4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C82H55N3/c1-9-25-56(26-10-1)60-41-45-66(46-42-60)77-55-78(84-82(83-77)67-47-43-61(44-48-67)57-27-11-2-12-28-57)70-53-73(64-37-21-7-22-38-64)79(74(54-70)65-39-23-8-24-40-65)85-80-71(62-33-17-5-18-34-62)49-68(58-29-13-3-14-30-58)51-75(80)76-52-69(59-31-15-4-16-32-59)50-72(81(76)85)63-35-19-6-20-36-63/h1-55H |
| InChIKey | INOXJQJLPMJVQP-UHFFFAOYSA-N |
| XLogP | 21.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1082.36 |
| LogP ≤ 5 | 21.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |