C69H46N4 — CID 146281025
9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole (PubChem CID 146281025) has the molecular formula C69H46N4 and a molecular weight of 931.16 g/mol. Its IUPAC name is 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole.
| Compound Name | 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole |
|---|---|
| PubChem CID | 146281025 |
| Molecular Formula | C69H46N4 |
| Molecular Weight | 931.16 g/mol |
| Exact Mass | 930.37 |
| IUPAC Name | 9-[4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccccc5)c(-n5c6c(-c7ccccc7)cccc6c6cccc(-c7ccccc7)c65)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C69H46N4/c1-7-21-47(22-8-1)49-37-41-55(42-38-49)67-70-68(56-43-39-50(40-44-56)48-23-9-2-10-24-48)72-69(71-67)57-45-62(53-29-15-5-16-30-53)66(63(46-57)54-31-17-6-18-32-54)73-64-58(51-25-11-3-12-26-51)33-19-35-60(64)61-36-20-34-59(65(61)73)52-27-13-4-14-28-52/h1-46H |
| InChIKey | KJTKBZSKITUTGJ-UHFFFAOYSA-N |
| XLogP | 17.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.16 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |