C70H47N3 — CID 169056002
9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole (PubChem CID 169056002) has the molecular formula C70H47N3 and a molecular weight of 930.17 g/mol. Its IUPAC name is 9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole.
| Compound Name | 9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole |
|---|---|
| PubChem CID | 169056002 |
| Molecular Formula | C70H47N3 |
| Molecular Weight | 930.17 g/mol |
| Exact Mass | 929.38 |
| IUPAC Name | 9-[4-[2,6-bis(4-phenylphenyl)pyrimidin-4-yl]-2,6-diphenylphenyl]-1,8-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4cc(-c5ccccc5)c(-n5c6c(-c7ccccc7)cccc6c6cccc(-c7ccccc7)c65)c(-c5ccccc5)c4)nc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C70H47N3/c1-7-21-48(22-8-1)50-37-41-56(42-38-50)65-47-66(72-70(71-65)57-43-39-51(40-44-57)49-23-9-2-10-24-49)58-45-63(54-29-15-5-16-30-54)69(64(46-58)55-31-17-6-18-32-55)73-67-59(52-25-11-3-12-26-52)33-19-35-61(67)62-36-20-34-60(68(62)73)53-27-13-4-14-28-53/h1-47H |
| InChIKey | CHPBVXYBBVRHKO-UHFFFAOYSA-N |
| XLogP | 18.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.17 |
| LogP ≤ 5 | 18.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |