C54H34N6 — CID 155656722
4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-isocyanophenyl)-2-[3-(4-methylphenyl)carbazol-9-yl]phenyl]benzonitrile (PubChem CID 155656722) has the molecular formula C54H34N6 and a molecular weight of 766.91 g/mol. Its IUPAC name is 4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-isocyanophenyl)-2-[3-(4-methylphenyl)carbazol-9-yl]phenyl]benzonitrile.
| Compound Name | 4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-isocyanophenyl)-2-[3-(4-methylphenyl)carbazol-9-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 155656722 |
| Molecular Formula | C54H34N6 |
| Molecular Weight | 766.91 g/mol |
| Exact Mass | 766.28 |
| IUPAC Name | 4-[5-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-(4-isocyanophenyl)-2-[3-(4-methylphenyl)carbazol-9-yl]phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3ccc(C#N)cc3)c2-n2c3ccccc3c3cc(-c4ccc(C)cc4)ccc32)cc1 |
| InChI | InChI=1S/C54H34N6/c1-35-17-21-37(22-18-35)42-27-30-50-48(31-42)45-15-9-10-16-49(45)60(50)51-46(38-23-19-36(34-55)20-24-38)32-43(33-47(51)39-25-28-44(56-2)29-26-39)54-58-52(40-11-5-3-6-12-40)57-53(59-54)41-13-7-4-8-14-41/h3-33H,1H3 |
| InChIKey | GOOLOINJNIPJDJ-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.91 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|