C64H45N5 — CID 155656675
4-[2-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)-3-(4-isocyanophenyl)phenyl]benzonitrile (PubChem CID 155656675) has the molecular formula C64H45N5 and a molecular weight of 884.10 g/mol. Its IUPAC name is 4-[2-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)-3-(4-isocyanophenyl)phenyl]benzonitrile.
| Compound Name | 4-[2-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)-3-(4-isocyanophenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155656675 |
| Molecular Formula | C64H45N5 |
| Molecular Weight | 884.10 g/mol |
| Exact Mass | 883.37 |
| IUPAC Name | 4-[2-[3,6-bis(3,5-dimethylphenyl)carbazol-9-yl]-5-(2,6-diphenylpyrimidin-4-yl)-3-(4-isocyanophenyl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3ccc(C#N)cc3)c2-n2c3ccc(-c4cc(C)cc(C)c4)cc3c3cc(-c4cc(C)cc(C)c4)ccc32)cc1 |
| InChI | InChI=1S/C64H45N5/c1-40-28-41(2)31-51(30-40)49-22-26-61-57(34-49)58-35-50(52-32-42(3)29-43(4)33-52)23-27-62(58)69(61)63-55(45-18-16-44(39-65)17-19-45)36-53(37-56(63)46-20-24-54(66-5)25-21-46)60-38-59(47-12-8-6-9-13-47)67-64(68-60)48-14-10-7-11-15-48/h6-38H,1-4H3 |
| InChIKey | YPJCLGVTILSGJE-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.10 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|