C53H44N4O — CID 155232686
2,7-ditert-butyl-9-[4-dibenzofuran-3-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 155232686) has the molecular formula C53H44N4O and a molecular weight of 752.96 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[4-dibenzofuran-3-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 2,7-ditert-butyl-9-[4-dibenzofuran-3-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 155232686 |
| Molecular Formula | C53H44N4O |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 752.35 |
| IUPAC Name | 2,7-ditert-butyl-9-[4-dibenzofuran-3-yl-2-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | CC(C)(C)c1ccc2c3ccc(C(C)(C)C)cc3n(-c3ccc(-c4ccc5c(c4)oc4ccccc45)cc3-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C53H44N4O/c1-52(2,3)37-23-26-39-40-27-24-38(53(4,5)6)32-46(40)57(45(39)31-37)44-28-22-35(36-21-25-42-41-19-13-14-20-47(41)58-48(42)30-36)29-43(44)51-55-49(33-15-9-7-10-16-33)54-50(56-51)34-17-11-8-12-18-34/h7-32H,1-6H3 |
| InChIKey | UGRLSLXGXDODAU-UHFFFAOYSA-N |
| XLogP | 14.13 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 14.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |