C71H42N8 — CID 155446453
3-[3-(3-cyanophenyl)-2-[3,6-di(carbazol-9-yl)carbazol-9-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile (PubChem CID 155446453) has the molecular formula C71H42N8 and a molecular weight of 1007.17 g/mol. Its IUPAC name is 3-[3-(3-cyanophenyl)-2-[3,6-di(carbazol-9-yl)carbazol-9-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile.
| Compound Name | 3-[3-(3-cyanophenyl)-2-[3,6-di(carbazol-9-yl)carbazol-9-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155446453 |
| Molecular Formula | C71H42N8 |
| Molecular Weight | 1007.17 g/mol |
| Exact Mass | 1006.35 |
| IUPAC Name | 3-[3-(3-cyanophenyl)-2-[3,6-di(carbazol-9-yl)carbazol-9-yl]-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc(-c3cccc(C#N)c3)c2-n2c3ccc(-n4c5ccccc5c5ccccc54)cc3c3cc(-n4c5ccccc5c5ccccc54)ccc32)c1 |
| InChI | InChI=1S/C71H42N8/c72-43-45-17-15-23-49(37-45)58-39-51(71-75-69(47-19-3-1-4-20-47)74-70(76-71)48-21-5-2-6-22-48)40-59(50-24-16-18-46(38-50)44-73)68(58)79-66-35-33-52(77-62-29-11-7-25-54(62)55-26-8-12-30-63(55)77)41-60(66)61-42-53(34-36-67(61)79)78-64-31-13-9-27-56(64)57-28-10-14-32-65(57)78/h1-42H |
| InChIKey | CMWQVAXLOZWYCT-UHFFFAOYSA-N |
| XLogP | 17.24 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.17 |
| LogP ≤ 5 | 17.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |