C64H44N8 — CID 170655610
2,3-diisocyano-11,12-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-4a,14b-dihydrophenanthro[9,10-b]quinoxaline-6,7-dicarbonitrile (PubChem CID 170655610) has the molecular formula C64H44N8 and a molecular weight of 925.11 g/mol. Its IUPAC name is 2,3-diisocyano-11,12-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-4a,14b-dihydrophenanthro[9,10-b]quinoxaline-6,7-dicarbonitrile.
| Compound Name | 2,3-diisocyano-11,12-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-4a,14b-dihydrophenanthro[9,10-b]quinoxaline-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 170655610 |
| Molecular Formula | C64H44N8 |
| Molecular Weight | 925.11 g/mol |
| Exact Mass | 924.37 |
| IUPAC Name | 2,3-diisocyano-11,12-bis[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-4a,14b-dihydrophenanthro[9,10-b]quinoxaline-6,7-dicarbonitrile |
| SMILES | [C-]#[N+]C1=CC2c3cc(C#N)c(C#N)cc3-c3nc4cc(-c5ccc(N(c6ccc(C)cc6)c6ccc(C)cc6)cc5)c(-c5ccc(N(c6ccc(C)cc6)c6ccc(C)cc6)cc5)cc4nc3C2C=C1[N+]#[C-] |
| InChI | InChI=1S/C64H44N8/c1-39-7-19-47(20-8-39)71(48-21-9-40(2)10-22-48)51-27-15-43(16-28-51)53-33-61-62(34-54(53)44-17-29-52(30-18-44)72(49-23-11-41(3)12-24-49)50-25-13-42(4)14-26-50)70-64-58-36-60(68-6)59(67-5)35-56(58)55-31-45(37-65)46(38-66)32-57(55)63(64)69-61/h7-36,56,58H,1-4H3 |
| InChIKey | OKTZZDXKAOUBSC-UHFFFAOYSA-N |
| XLogP | 16.35 |
| TPSA | 88.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.11 |
| LogP ≤ 5 | 16.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|