C46H33N3 — CID 59055950
5-isocyano-10-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9-[2-(4-methylphenyl)ethenyl]anthracene-1-carbonitrile (PubChem CID 59055950) has the molecular formula C46H33N3 and a molecular weight of 627.79 g/mol. Its IUPAC name is 5-isocyano-10-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9-[2-(4-methylphenyl)ethenyl]anthracene-1-carbonitrile.
| Compound Name | 5-isocyano-10-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9-[2-(4-methylphenyl)ethenyl]anthracene-1-carbonitrile |
|---|---|
| PubChem CID | 59055950 |
| Molecular Formula | C46H33N3 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 5-isocyano-10-[2-[4-(N-(4-methylphenyl)anilino)phenyl]ethenyl]-9-[2-(4-methylphenyl)ethenyl]anthracene-1-carbonitrile |
| SMILES | [C-]#[N+]c1cccc2c(C=Cc3ccc(C)cc3)c3c(C#N)cccc3c(C=Cc3ccc(N(c4ccccc4)c4ccc(C)cc4)cc3)c12 |
| InChI | InChI=1S/C46H33N3/c1-32-15-19-34(20-16-32)23-29-42-41-13-8-14-44(48-3)46(41)43(40-12-7-9-36(31-47)45(40)42)30-24-35-21-27-39(28-22-35)49(37-10-5-4-6-11-37)38-25-17-33(2)18-26-38/h4-30H,1-2H3 |
| InChIKey | UHLQHHSOMITXJF-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|