C47H28N4S2 — CID 164711105
6-[6-[4-(1,3-benzothiazol-2-yl)-N-[4-(1,3-benzothiazol-2-yl)phenyl]anilino]-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl]naphthalene-2-carbonitrile (PubChem CID 164711105) has the molecular formula C47H28N4S2 and a molecular weight of 718.94 g/mol. Its IUPAC name is 6-[6-[4-(1,3-benzothiazol-2-yl)-N-[4-(1,3-benzothiazol-2-yl)phenyl]anilino]-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl]naphthalene-2-carbonitrile.
| Compound Name | 6-[6-[4-(1,3-benzothiazol-2-yl)-N-[4-(1,3-benzothiazol-2-yl)phenyl]anilino]-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 164711105 |
| Molecular Formula | C47H28N4S2 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.21 |
| IUPAC Name | 6-[6-[4-(1,3-benzothiazol-2-yl)-N-[4-(1,3-benzothiazol-2-yl)phenyl]anilino]-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl]naphthalene-2-carbonitrile |
| SMILES | [2H]c1c(N(c2ccc(-c3nc4ccccc4s3)cc2)c2ccc(-c3nc4ccccc4s3)cc2)c([2H])c2c([2H])c([2H])c(-c3ccc4cc(C#N)ccc4c3)c([2H])c2c1[2H] |
| InChI | InChI=1S/C47H28N4S2/c48-29-30-9-10-34-26-35(12-11-33(34)25-30)36-13-14-38-28-41(24-19-37(38)27-36)51(39-20-15-31(16-21-39)46-49-42-5-1-3-7-44(42)52-46)40-22-17-32(18-23-40)47-50-43-6-2-4-8-45(43)53-47/h1-28H/i13D,14D,19D,24D,27D,28D |
| InChIKey | LRFDPNLDSFFEJU-WILCYIFHSA-N |
| XLogP | 13.55 |
| TPSA | 52.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |