C40H23N5 — CID 169061456
4-[4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile (PubChem CID 169061456) has the molecular formula C40H23N5 and a molecular weight of 573.66 g/mol. Its IUPAC name is 4-[4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169061456 |
| Molecular Formula | C40H23N5 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 4-[4-[N-[4-(3-cyanophenyl)phenyl]-4-(3-isocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(N(c3ccc(-c4cccc(C#N)c4)cc3)c3ccc(-c4ccc(C#N)c(C#N)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C40H23N5/c1-44-37-7-3-6-33(24-37)30-12-18-39(19-13-30)45(38-16-10-29(11-17-38)32-5-2-4-28(22-32)25-41)40-20-14-31(15-21-40)34-8-9-35(26-42)36(23-34)27-43/h2-24H |
| InChIKey | WKSVGFFGFYXOHM-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|