C42H21N7 — CID 169061626
4-[4-[N-[4-(3-cyano-5-isocyanophenyl)phenyl]-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile (PubChem CID 169061626) has the molecular formula C42H21N7 and a molecular weight of 623.68 g/mol. Its IUPAC name is 4-[4-[N-[4-(3-cyano-5-isocyanophenyl)phenyl]-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[N-[4-(3-cyano-5-isocyanophenyl)phenyl]-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169061626 |
| Molecular Formula | C42H21N7 |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | 4-[4-[N-[4-(3-cyano-5-isocyanophenyl)phenyl]-4-(3,4-diisocyanophenyl)anilino]phenyl]benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(-c2ccc(N(c3ccc(-c4ccc(C#N)c(C#N)c4)cc3)c3ccc(-c4ccc([N+]#[C-])c([N+]#[C-])c4)cc3)cc2)c1 |
| InChI | InChI=1S/C42H21N7/c1-46-37-21-28(25-43)20-35(23-37)31-10-17-40(18-11-31)49(38-13-6-29(7-14-38)32-4-5-34(26-44)36(22-32)27-45)39-15-8-30(9-16-39)33-12-19-41(47-2)42(24-33)48-3/h4-24H |
| InChIKey | ABHIUTYQHOPRFX-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 87.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|