C27H20N4 — CID 59702645
3-[6-[2-[5-(3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-3-pyridinyl]benzonitrile (PubChem CID 59702645) has the molecular formula C27H20N4 and a molecular weight of 400.49 g/mol. Its IUPAC name is 3-[6-[2-[5-(3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-3-pyridinyl]benzonitrile.
| Compound Name | 3-[6-[2-[5-(3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 59702645 |
| Molecular Formula | C27H20N4 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-[6-[2-[5-(3-isocyanophenyl)-2-pyridinyl]propan-2-yl]-3-pyridinyl]benzonitrile |
| SMILES | [C-]#[N+]c1cccc(-c2ccc(C(C)(C)c3ccc(-c4cccc(C#N)c4)cn3)nc2)c1 |
| InChI | InChI=1S/C27H20N4/c1-27(2,25-12-10-22(17-30-25)20-7-4-6-19(14-20)16-28)26-13-11-23(18-31-26)21-8-5-9-24(15-21)29-3/h4-15,17-18H,1-2H3 |
| InChIKey | RWEULKOLRXCMNQ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|