C37H22N4O — CID 169061655
N-(4-dibenzofuran-4-ylphenyl)-3,4-diisocyano-N-(4-pyridin-4-ylphenyl)aniline (PubChem CID 169061655) has the molecular formula C37H22N4O and a molecular weight of 538.61 g/mol. Its IUPAC name is N-(4-dibenzofuran-4-ylphenyl)-3,4-diisocyano-N-(4-pyridin-4-ylphenyl)aniline.
| Compound Name | N-(4-dibenzofuran-4-ylphenyl)-3,4-diisocyano-N-(4-pyridin-4-ylphenyl)aniline |
|---|---|
| PubChem CID | 169061655 |
| Molecular Formula | C37H22N4O |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | N-(4-dibenzofuran-4-ylphenyl)-3,4-diisocyano-N-(4-pyridin-4-ylphenyl)aniline |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(-c3ccncc3)cc2)c2ccc(-c3cccc4c3oc3ccccc34)cc2)cc1[N+]#[C-] |
| InChI | InChI=1S/C37H22N4O/c1-38-34-19-18-30(24-35(34)39-2)41(28-14-10-25(11-15-28)26-20-22-40-23-21-26)29-16-12-27(13-17-29)31-7-5-8-33-32-6-3-4-9-36(32)42-37(31)33/h3-24H |
| InChIKey | NCVHXBFPKLEBRJ-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 37.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|