C21H17FN4S — CID 24501779
1-[4-(1H-benzimidazol-2-yl)phenyl]-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 24501779) has the molecular formula C21H17FN4S and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-yl)phenyl]-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[4-(1H-benzimidazol-2-yl)phenyl]-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 24501779 |
| Molecular Formula | C21H17FN4S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-yl)phenyl]-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(-c3nc4ccccc4[nH]3)cc2)cc1F |
| InChI | InChI=1S/C21H17FN4S/c1-13-6-9-16(12-17(13)22)24-21(27)23-15-10-7-14(8-11-15)20-25-18-4-2-3-5-19(18)26-20/h2-12H,1H3,(H,25,26)(H2,23,24,27) |
| InChIKey | FWWALACYERJZNJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|