C29H26N6O2S2 — CID 2488329
1-(4-methoxyphenyl)-3-[4-[6-[(4-methoxyphenyl)carbamothioylamino]-1H-benzimidazol-2-yl]phenyl]thiourea (PubChem CID 2488329) has the molecular formula C29H26N6O2S2 and a molecular weight of 554.70 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[4-[6-[(4-methoxyphenyl)carbamothioylamino]-1H-benzimidazol-2-yl]phenyl]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[4-[6-[(4-methoxyphenyl)carbamothioylamino]-1H-benzimidazol-2-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 2488329 |
| Molecular Formula | C29H26N6O2S2 |
| Molecular Weight | 554.70 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[4-[6-[(4-methoxyphenyl)carbamothioylamino]-1H-benzimidazol-2-yl]phenyl]thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(-c3nc4ccc(NC(=S)Nc5ccc(OC)cc5)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C29H26N6O2S2/c1-36-23-12-7-20(8-13-23)31-28(38)30-19-5-3-18(4-6-19)27-34-25-16-11-22(17-26(25)35-27)33-29(39)32-21-9-14-24(37-2)15-10-21/h3-17H,1-2H3,(H,34,35)(H2,30,31,38)(H2,32,33,39) |
| InChIKey | FODTUJYPTVZMGH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.70 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|