C17H15Cl2N3O2 — CID 82564622
ethyl 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylate (PubChem CID 82564622) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is ethyl 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 82564622 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | ethyl 2-[(3,5-dichlorophenyl)methylamino]-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NCc3cc(Cl)cc(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C17H15Cl2N3O2/c1-2-24-16(23)11-3-4-14-15(7-11)22-17(21-14)20-9-10-5-12(18)8-13(19)6-10/h3-8H,2,9H2,1H3,(H2,20,21,22) |
| InChIKey | AVONFCBXMMBQPK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |