C15H15N3O2S — CID 82564599
ethyl 2-(thiophen-2-ylmethylamino)-3H-benzimidazole-5-carboxylate (PubChem CID 82564599) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is ethyl 2-(thiophen-2-ylmethylamino)-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-(thiophen-2-ylmethylamino)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 82564599 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | ethyl 2-(thiophen-2-ylmethylamino)-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NCc3cccs3)[nH]c2c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-2-20-14(19)10-5-6-12-13(8-10)18-15(17-12)16-9-11-4-3-7-21-11/h3-8H,2,9H2,1H3,(H2,16,17,18) |
| InChIKey | CGFXVVLADBJERX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |