C16H13F2N3O2 — CID 82563145
ethyl 2-(2,6-difluoroanilino)-3H-benzimidazole-5-carboxylate (PubChem CID 82563145) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is ethyl 2-(2,6-difluoroanilino)-3H-benzimidazole-5-carboxylate.
| Compound Name | ethyl 2-(2,6-difluoroanilino)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 82563145 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethyl 2-(2,6-difluoroanilino)-3H-benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(Nc3c(F)cccc3F)[nH]c2c1 |
| InChI | InChI=1S/C16H13F2N3O2/c1-2-23-15(22)9-6-7-12-13(8-9)20-16(19-12)21-14-10(17)4-3-5-11(14)18/h3-8H,2H2,1H3,(H2,19,20,21) |
| InChIKey | RWEXFWGTHNWJTR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |