C29H32N2O2 — CID 166632914
3-[[(4-tert-butylphenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]-1H-quinolin-2-one (PubChem CID 166632914) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 3-[[(4-tert-butylphenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]-1H-quinolin-2-one.
| Compound Name | 3-[[(4-tert-butylphenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 166632914 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 3-[[(4-tert-butylphenyl)methyl-[(4-methoxyphenyl)methyl]amino]methyl]-1H-quinolin-2-one |
| SMILES | COc1ccc(CN(Cc2ccc(C(C)(C)C)cc2)Cc2cc3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C29H32N2O2/c1-29(2,3)25-13-9-21(10-14-25)18-31(19-22-11-15-26(33-4)16-12-22)20-24-17-23-7-5-6-8-27(23)30-28(24)32/h5-17H,18-20H2,1-4H3,(H,30,32) |
| InChIKey | SAEGHCIGGMNDNI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |