C24H28N6O2 — CID 1171472
3-[[benzyl-[(1-tert-butyltetrazol-5-yl)methyl]amino]methyl]-7-methoxy-1H-quinolin-2-one (PubChem CID 1171472) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 3-[[benzyl-[(1-tert-butyltetrazol-5-yl)methyl]amino]methyl]-7-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[[benzyl-[(1-tert-butyltetrazol-5-yl)methyl]amino]methyl]-7-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1171472 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 3-[[benzyl-[(1-tert-butyltetrazol-5-yl)methyl]amino]methyl]-7-methoxy-1H-quinolin-2-one |
| SMILES | COc1ccc2cc(CN(Cc3ccccc3)Cc3nnnn3C(C)(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H28N6O2/c1-24(2,3)30-22(26-27-28-30)16-29(14-17-8-6-5-7-9-17)15-19-12-18-10-11-20(32-4)13-21(18)25-23(19)31/h5-13H,14-16H2,1-4H3,(H,25,31) |
| InChIKey | WNEVNSUHQKQXQZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |