C26H32N6O2 — CID 3199483
3-[[benzyl-[1-(1-tert-butyltetrazol-5-yl)propyl]amino]methyl]-7-methoxy-1H-quinolin-2-one (PubChem CID 3199483) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-[[benzyl-[1-(1-tert-butyltetrazol-5-yl)propyl]amino]methyl]-7-methoxy-1H-quinolin-2-one.
| Compound Name | 3-[[benzyl-[1-(1-tert-butyltetrazol-5-yl)propyl]amino]methyl]-7-methoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3199483 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 3-[[benzyl-[1-(1-tert-butyltetrazol-5-yl)propyl]amino]methyl]-7-methoxy-1H-quinolin-2-one |
| SMILES | CCC(c1nnnn1C(C)(C)C)N(Cc1ccccc1)Cc1cc2ccc(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C26H32N6O2/c1-6-23(24-28-29-30-32(24)26(2,3)4)31(16-18-10-8-7-9-11-18)17-20-14-19-12-13-21(34-5)15-22(19)27-25(20)33/h7-15,23H,6,16-17H2,1-5H3,(H,27,33) |
| InChIKey | KMHJSVXJUCTHQH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |