C18H27N3O2+2 — CID 7107864
(7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium (PubChem CID 7107864) has the molecular formula C18H27N3O2+2 and a molecular weight of 317.43 g/mol. Its IUPAC name is (7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium.
| Compound Name | (7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 7107864 |
| Molecular Formula | C18H27N3O2+2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | (7-methyl-2-oxo-1H-quinolin-3-yl)methyl-(3-morpholin-4-ium-4-ylpropyl)azanium |
| SMILES | Cc1ccc2cc(C[NH2+]CCC[NH+]3CCOCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H25N3O2/c1-14-3-4-15-12-16(18(22)20-17(15)11-14)13-19-5-2-6-21-7-9-23-10-8-21/h3-4,11-12,19H,2,5-10,13H2,1H3,(H,20,22)/p+2 |
| InChIKey | NOOGVLKSGNUGSH-UHFFFAOYSA-P |
| XLogP | -0.79 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|