C20H29N4O3S+ — CID 6970121
1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(3-morpholin-4-ium-4-ylpropyl)thiourea (PubChem CID 6970121) has the molecular formula C20H29N4O3S+ and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(3-morpholin-4-ium-4-ylpropyl)thiourea.
| Compound Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(3-morpholin-4-ium-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 6970121 |
| Molecular Formula | C20H29N4O3S+ |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(3-morpholin-4-ium-4-ylpropyl)thiourea |
| SMILES | CNC(=S)N(CCC[NH+]1CCOCC1)Cc1cc2ccc(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C20H28N4O3S/c1-21-20(28)24(7-3-6-23-8-10-27-11-9-23)14-16-12-15-4-5-17(26-2)13-18(15)22-19(16)25/h4-5,12-13H,3,6-11,14H2,1-2H3,(H,21,28)(H,22,25)/p+1 |
| InChIKey | AIONDBVDTNEAET-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|