C24H29N4O4+ — CID 6970130
1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)-3-phenylurea (PubChem CID 6970130) has the molecular formula C24H29N4O4+ and a molecular weight of 437.52 g/mol. Its IUPAC name is 1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)-3-phenylurea.
| Compound Name | 1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)-3-phenylurea |
|---|---|
| PubChem CID | 6970130 |
| Molecular Formula | C24H29N4O4+ |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)-3-phenylurea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(CC[NH+]3CCOCC3)C(=O)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C24H28N4O4/c1-31-21-7-8-22-18(16-21)15-19(23(29)26-22)17-28(10-9-27-11-13-32-14-12-27)24(30)25-20-5-3-2-4-6-20/h2-8,15-16H,9-14,17H2,1H3,(H,25,30)(H,26,29)/p+1 |
| InChIKey | AIAIMNMRRNEVSE-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |