C20H29N4O2S+ — CID 6970093
1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 6970093) has the molecular formula C20H29N4O2S+ and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 6970093 |
| Molecular Formula | C20H29N4O2S+ |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-methyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CNC(=S)N(CC[NH+]1CCOCC1)Cc1cc2cc(C)c(C)cc2[nH]c1=O |
| InChI | InChI=1S/C20H28N4O2S/c1-14-10-16-12-17(19(25)22-18(16)11-15(14)2)13-24(20(27)21-3)5-4-23-6-8-26-9-7-23/h10-12H,4-9,13H2,1-3H3,(H,21,27)(H,22,25)/p+1 |
| InChIKey | VYXHWOHGELXWMK-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|