C22H33N4O2S+ — CID 7116737
3-[(2R)-butan-2-yl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7116737) has the molecular formula C22H33N4O2S+ and a molecular weight of 417.60 g/mol. Its IUPAC name is 3-[(2R)-butan-2-yl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 3-[(2R)-butan-2-yl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7116737 |
| Molecular Formula | C22H33N4O2S+ |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 3-[(2R)-butan-2-yl]-1-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CC[C@@H](C)NC(=S)N(CC[NH+]1CCOCC1)Cc1cc2cccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C22H32N4O2S/c1-4-17(3)23-22(29)26(9-8-25-10-12-28-13-11-25)15-19-14-18-7-5-6-16(2)20(18)24-21(19)27/h5-7,14,17H,4,8-13,15H2,1-3H3,(H,23,29)(H,24,27)/p+1/t17-/m1/s1 |
| InChIKey | RJHGQGUWHYWOPO-QGZVFWFLSA-O |
| XLogP | 1.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|