C23H34N4O2S — CID 7116748
3-[(2S)-butan-2-yl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 7116748) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 3-[(2S)-butan-2-yl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7116748 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CC[C@H](C)NC(=S)N(CCN1CCOCC1)Cc1cc2ccc(C)c(C)c2[nH]c1=O |
| InChI | InChI=1S/C23H34N4O2S/c1-5-17(3)24-23(30)27(9-8-26-10-12-29-13-11-26)15-20-14-19-7-6-16(2)18(4)21(19)25-22(20)28/h6-7,14,17H,5,8-13,15H2,1-4H3,(H,24,30)(H,25,28)/t17-/m0/s1 |
| InChIKey | OZIOZRFCUIBKPI-KRWDZBQOSA-N |
| XLogP | 2.95 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|