C22H35N4OS+ — CID 7116735
2-[[(2S)-butan-2-yl]carbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium (PubChem CID 7116735) has the molecular formula C22H35N4OS+ and a molecular weight of 403.62 g/mol. Its IUPAC name is 2-[[(2S)-butan-2-yl]carbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[[(2S)-butan-2-yl]carbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 7116735 |
| Molecular Formula | C22H35N4OS+ |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[[(2S)-butan-2-yl]carbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-diethylazanium |
| SMILES | CC[C@H](C)NC(=S)N(CC[NH+](CC)CC)Cc1cc2cccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C22H34N4OS/c1-6-17(5)23-22(28)26(13-12-25(7-2)8-3)15-19-14-18-11-9-10-16(4)20(18)24-21(19)27/h9-11,14,17H,6-8,12-13,15H2,1-5H3,(H,23,28)(H,24,27)/p+1/t17-/m0/s1 |
| InChIKey | NCTJHZWOKXAODR-KRWDZBQOSA-O |
| XLogP | 2.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|