C21H33N4OS+ — CID 7116803
3-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(methylcarbamothioyl)amino]propyl-diethylazanium (PubChem CID 7116803) has the molecular formula C21H33N4OS+ and a molecular weight of 389.59 g/mol. Its IUPAC name is 3-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(methylcarbamothioyl)amino]propyl-diethylazanium.
| Compound Name | 3-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(methylcarbamothioyl)amino]propyl-diethylazanium |
|---|---|
| PubChem CID | 7116803 |
| Molecular Formula | C21H33N4OS+ |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 3-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(methylcarbamothioyl)amino]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCN(Cc1cc2cc(C)cc(C)c2[nH]c1=O)C(=S)NC |
| InChI | InChI=1S/C21H32N4OS/c1-6-24(7-2)9-8-10-25(21(27)22-5)14-18-13-17-12-15(3)11-16(4)19(17)23-20(18)26/h11-13H,6-10,14H2,1-5H3,(H,22,27)(H,23,26)/p+1 |
| InChIKey | FPQFWUAOHTWHSY-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|