C25H31ClN4OS — CID 3172724
3-(3-chlorophenyl)-1-[2-(diethylamino)ethyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3172724) has the molecular formula C25H31ClN4OS and a molecular weight of 471.07 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[2-(diethylamino)ethyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-(3-chlorophenyl)-1-[2-(diethylamino)ethyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3172724 |
| Molecular Formula | C25H31ClN4OS |
| Molecular Weight | 471.07 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[2-(diethylamino)ethyl]-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCN(CC)CCN(Cc1cc2cc(C)cc(C)c2[nH]c1=O)C(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H31ClN4OS/c1-5-29(6-2)10-11-30(25(32)27-22-9-7-8-21(26)15-22)16-20-14-19-13-17(3)12-18(4)23(19)28-24(20)31/h7-9,12-15H,5-6,10-11,16H2,1-4H3,(H,27,32)(H,28,31) |
| InChIKey | KQHZTWVBGXBHAH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.07 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|