C23H27ClN4OS — CID 1138287
3-(3-chlorophenyl)-1-[2-(dimethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1138287) has the molecular formula C23H27ClN4OS and a molecular weight of 443.02 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[2-(dimethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-(3-chlorophenyl)-1-[2-(dimethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1138287 |
| Molecular Formula | C23H27ClN4OS |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[2-(dimethylamino)ethyl]-1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | Cc1ccc(C)c2[nH]c(=O)c(CN(CCN(C)C)C(=S)Nc3cccc(Cl)c3)cc12 |
| InChI | InChI=1S/C23H27ClN4OS/c1-15-8-9-16(2)21-20(15)12-17(22(29)26-21)14-28(11-10-27(3)4)23(30)25-19-7-5-6-18(24)13-19/h5-9,12-13H,10-11,14H2,1-4H3,(H,25,30)(H,26,29) |
| InChIKey | HOBSRDJEGISVAT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|