C16H21N3O2S — CID 862204
1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-methylthiourea (PubChem CID 862204) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-methylthiourea.
| Compound Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-methylthiourea |
|---|---|
| PubChem CID | 862204 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-methylthiourea |
| SMILES | CNC(=S)N(CCO)Cc1cc2c(C)ccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C16H21N3O2S/c1-10-4-5-11(2)14-13(10)8-12(15(21)18-14)9-19(6-7-20)16(22)17-3/h4-5,8,20H,6-7,9H2,1-3H3,(H,17,22)(H,18,21) |
| InChIKey | AMKFWULBIZCGBJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|