C21H27N4O2S+ — CID 7108742
2-[furan-2-ylmethylcarbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium (PubChem CID 7108742) has the molecular formula C21H27N4O2S+ and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-[furan-2-ylmethylcarbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[furan-2-ylmethylcarbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7108742 |
| Molecular Formula | C21H27N4O2S+ |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 2-[furan-2-ylmethylcarbamothioyl-[(8-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium |
| SMILES | Cc1cccc2cc(CN(CC[NH+](C)C)C(=S)NCc3ccco3)c(=O)[nH]c12 |
| InChI | InChI=1S/C21H26N4O2S/c1-15-6-4-7-16-12-17(20(26)23-19(15)16)14-25(10-9-24(2)3)21(28)22-13-18-8-5-11-27-18/h4-8,11-12H,9-10,13-14H2,1-3H3,(H,22,28)(H,23,26)/p+1 |
| InChIKey | DCHHLPCXVHVGIN-UHFFFAOYSA-O |
| XLogP | 1.45 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|