C21H31N4O2S+ — CID 6972592
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 6972592) has the molecular formula C21H31N4O2S+ and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 6972592 |
| Molecular Formula | C21H31N4O2S+ |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-ethyl-1-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | CCNC(=S)N(CC[NH+]1CCOCC1)Cc1cc2ccc(C)c(C)c2[nH]c1=O |
| InChI | InChI=1S/C21H30N4O2S/c1-4-22-21(28)25(8-7-24-9-11-27-12-10-24)14-18-13-17-6-5-15(2)16(3)19(17)23-20(18)26/h5-6,13H,4,7-12,14H2,1-3H3,(H,22,28)(H,23,26)/p+1 |
| InChIKey | KCBNFGRMUGOXES-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|