C11H16O4P+ — CID 71391917
(2,4-dimethoxyphenyl)methyl-ethoxy-oxophosphanium (PubChem CID 71391917) has the molecular formula C11H16O4P+ and a molecular weight of 243.22 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-ethoxy-oxophosphanium.
| Compound Name | (2,4-dimethoxyphenyl)methyl-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 71391917 |
| Molecular Formula | C11H16O4P+ |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C11H16O4P/c1-4-15-16(12)8-9-5-6-10(13-2)7-11(9)14-3/h5-7H,4,8H2,1-3H3/q+1 |
| InChIKey | VDIMQWSRWROYRL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|