C46H49Br3N2O6 — CID 164962485
N-[4-(3-bromopropoxy)phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline;1,3-dibromopropane;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol (PubChem CID 164962485) has the molecular formula C46H49Br3N2O6 and a molecular weight of 965.62 g/mol. Its IUPAC name is N-[4-(3-bromopropoxy)phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline;1,3-dibromopropane;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol.
| Compound Name | N-[4-(3-bromopropoxy)phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline;1,3-dibromopropane;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol |
|---|---|
| PubChem CID | 164962485 |
| Molecular Formula | C46H49Br3N2O6 |
| Molecular Weight | 965.62 g/mol |
| Exact Mass | 962.11 |
| IUPAC Name | N-[4-(3-bromopropoxy)phenyl]-4-methoxy-N-(4-methoxyphenyl)aniline;1,3-dibromopropane;4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenol |
| SMILES | BrCCCBr.COc1ccc(N(c2ccc(O)cc2)c2ccc(OC)cc2)cc1.COc1ccc(N(c2ccc(OC)cc2)c2ccc(OCCCBr)cc2)cc1 |
| InChI | InChI=1S/C23H24BrNO3.C20H19NO3.C3H6Br2/c1-26-21-10-4-18(5-11-21)25(19-6-12-22(27-2)13-7-19)20-8-14-23(15-9-20)28-17-3-16-24;1-23-19-11-5-16(6-12-19)21(15-3-9-18(22)10-4-15)17-7-13-20(24-2)14-8-17;4-2-1-3-5/h4-15H,3,16-17H2,1-2H3;3-14,22H,1-2H3;1-3H2 |
| InChIKey | CALVMVNWRYSGSN-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 965.62 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|