C32H32N6O2 — CID 89352450
4-N-[4-(4-amino-N-(4-aminophenyl)anilino)phenyl]-4-N-(4-amino-3-methoxyphenyl)-2-methoxybenzene-1,4-diamine (PubChem CID 89352450) has the molecular formula C32H32N6O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is 4-N-[4-(4-amino-N-(4-aminophenyl)anilino)phenyl]-4-N-(4-amino-3-methoxyphenyl)-2-methoxybenzene-1,4-diamine.
| Compound Name | 4-N-[4-(4-amino-N-(4-aminophenyl)anilino)phenyl]-4-N-(4-amino-3-methoxyphenyl)-2-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 89352450 |
| Molecular Formula | C32H32N6O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 4-N-[4-(4-amino-N-(4-aminophenyl)anilino)phenyl]-4-N-(4-amino-3-methoxyphenyl)-2-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(N(c2ccc(N(c3ccc(N)cc3)c3ccc(N)cc3)cc2)c2ccc(N)c(OC)c2)ccc1N |
| InChI | InChI=1S/C32H32N6O2/c1-39-31-19-27(15-17-29(31)35)38(28-16-18-30(36)32(20-28)40-2)26-13-11-25(12-14-26)37(23-7-3-21(33)4-8-23)24-9-5-22(34)6-10-24/h3-20H,33-36H2,1-2H3 |
| InChIKey | ZXBAQHOUXIIWMT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 129.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|