C8H12N2O3S — CID 175558258
1-amino-2-methoxy-4-[methyl(sulfino)amino]benzene (PubChem CID 175558258) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-amino-2-methoxy-4-[methyl(sulfino)amino]benzene.
| Compound Name | 1-amino-2-methoxy-4-[methyl(sulfino)amino]benzene |
|---|---|
| PubChem CID | 175558258 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-amino-2-methoxy-4-[methyl(sulfino)amino]benzene |
| SMILES | COc1cc(N(C)S(=O)O)ccc1N |
| InChI | InChI=1S/C8H12N2O3S/c1-10(14(11)12)6-3-4-7(9)8(5-6)13-2/h3-5H,9H2,1-2H3,(H,11,12) |
| InChIKey | GPPPRDBEUXTLLS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|