C24H17Br2NS — CID 67494789
N,N-bis(4-bromophenyl)-4-[(E)-2-thiophen-2-ylethenyl]aniline (PubChem CID 67494789) has the molecular formula C24H17Br2NS and a molecular weight of 511.28 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-4-[(E)-2-thiophen-2-ylethenyl]aniline.
| Compound Name | N,N-bis(4-bromophenyl)-4-[(E)-2-thiophen-2-ylethenyl]aniline |
|---|---|
| PubChem CID | 67494789 |
| Molecular Formula | C24H17Br2NS |
| Molecular Weight | 511.28 g/mol |
| Exact Mass | 508.94 |
| IUPAC Name | N,N-bis(4-bromophenyl)-4-[(E)-2-thiophen-2-ylethenyl]aniline |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2)c2ccc(/C=C/c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C24H17Br2NS/c25-19-6-12-22(13-7-19)27(23-14-8-20(26)9-15-23)21-10-3-18(4-11-21)5-16-24-2-1-17-28-24/h1-17H/b16-5+ |
| InChIKey | WQAVELDNLGLQSH-FZSIALSZSA-N |
| XLogP | 8.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.28 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |